C12H17NO — CID 160922016
7-propan-2-yl-3,4-dihydro-2H-chromen-8-amine (PubChem CID 160922016) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 7-propan-2-yl-3,4-dihydro-2H-chromen-8-amine.
| Compound Name | 7-propan-2-yl-3,4-dihydro-2H-chromen-8-amine |
|---|---|
| PubChem CID | 160922016 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 7-propan-2-yl-3,4-dihydro-2H-chromen-8-amine |
| SMILES | CC(C)c1ccc2c(c1N)OCCC2 |
| InChI | InChI=1S/C12H17NO/c1-8(2)10-6-5-9-4-3-7-14-12(9)11(10)13/h5-6,8H,3-4,7,13H2,1-2H3 |
| InChIKey | SSDSAZYAPYQMNB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|