C10H12ClNO — CID 78961328
(4S)-5-chloro-8-methyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 78961328) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is (4S)-5-chloro-8-methyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-5-chloro-8-methyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 78961328 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (4S)-5-chloro-8-methyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Cc1ccc(Cl)c2c1OCC[C@@H]2N |
| InChI | InChI=1S/C10H12ClNO/c1-6-2-3-7(11)9-8(12)4-5-13-10(6)9/h2-3,8H,4-5,12H2,1H3/t8-/m0/s1 |
| InChIKey | NUBNBRCQJMDNIV-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |