C18H18O3S — CID 10734047
(5R,6R)-6-hydroxy-5,6-diphenyl-1,4-oxathiocan-8-one (PubChem CID 10734047) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (5R,6R)-6-hydroxy-5,6-diphenyl-1,4-oxathiocan-8-one.
| Compound Name | (5R,6R)-6-hydroxy-5,6-diphenyl-1,4-oxathiocan-8-one |
|---|---|
| PubChem CID | 10734047 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (5R,6R)-6-hydroxy-5,6-diphenyl-1,4-oxathiocan-8-one |
| SMILES | O=C1C[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)SCCO1 |
| InChI | InChI=1S/C18H18O3S/c19-16-13-18(20,15-9-5-2-6-10-15)17(22-12-11-21-16)14-7-3-1-4-8-14/h1-10,17,20H,11-13H2/t17-,18-/m1/s1 |
| InChIKey | RIYSCTBXEABPBL-QZTJIDSGSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |