4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid

C17H16O3 — CID 101370979

IUPAC4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid
SMILESO=C(O)c1ccc([C@@]2(O)CC[C@@H]2c2ccccc2)cc1
InChIInChI=1S/C17H16O3/c18-16(19)13-6-8-14(9-7-13)17(20)11-10-15(17)12-4-2-1-3-5-12/h1-9,15,20H,10-11H2,(H,18,19)/t15-,17+/m1/s1
InChIKeyDDFFWZUPFWOMFN-WBVHZDCISA-N
MW268.31 g/mol
LogP3.15
Rot. Bonds3

About 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid

4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid (PubChem CID 101370979) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid.

Molecular Properties

Compound Name4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid
PubChem CID101370979
Molecular FormulaC17H16O3
Molecular Weight268.31 g/mol
Exact Mass268.11
IUPAC Name4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid
SMILESO=C(O)c1ccc([C@@]2(O)CC[C@@H]2c2ccccc2)cc1
InChIInChI=1S/C17H16O3/c18-16(19)13-6-8-14(9-7-13)17(20)11-10-15(17)12-4-2-1-3-5-12/h1-9,15,20H,10-11H2,(H,18,19)/t15-,17+/m1/s1
InChIKeyDDFFWZUPFWOMFN-WBVHZDCISA-N
XLogP3.15
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid?
The IUPAC name of 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid (CID 101370979) is 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid.
What is the SMILES notation for 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid?
The canonical SMILES for 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid is O=C(O)c1ccc([C@@]2(O)CC[C@@H]2c2ccccc2)cc1.
What is the InChIKey of 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid?
The InChIKey is DDFFWZUPFWOMFN-WBVHZDCISA-N. The full InChI is InChI=1S/C17H16O3/c18-16(19)13-6-8-14(9-7-13)17(20)11-10-15(17)12-4-2-1-3-5-12/h1-9,15,20H,10-11H2,(H,18,19)/t15-,17+/m1/s1.
What are the key properties of 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid?
4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid has a molecular weight of 268.31 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid is sourced from PubChem (CID 101370979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).