C17H16O3 — CID 101243575
4-[(1S,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid (PubChem CID 101243575) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[(1S,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid.
| Compound Name | 4-[(1S,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid |
|---|---|
| PubChem CID | 101243575 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[(1S,2R)-1-hydroxy-2-phenylcyclobutyl]benzoic acid |
| SMILES | O=C(O)c1ccc([C@]2(O)CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16O3/c18-16(19)13-6-8-14(9-7-13)17(20)11-10-15(17)12-4-2-1-3-5-12/h1-9,15,20H,10-11H2,(H,18,19)/t15-,17-/m1/s1 |
| InChIKey | DDFFWZUPFWOMFN-NVXWUHKLSA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |