C23H20O2 — CID 98160666
(2R,3S,4R)-4-hydroxy-2,3,4-triphenylcyclopentan-1-one (PubChem CID 98160666) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2R,3S,4R)-4-hydroxy-2,3,4-triphenylcyclopentan-1-one.
| Compound Name | (2R,3S,4R)-4-hydroxy-2,3,4-triphenylcyclopentan-1-one |
|---|---|
| PubChem CID | 98160666 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2R,3S,4R)-4-hydroxy-2,3,4-triphenylcyclopentan-1-one |
| SMILES | O=C1C[C@](O)(c2ccccc2)[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H20O2/c24-20-16-23(25,19-14-8-3-9-15-19)22(18-12-6-2-7-13-18)21(20)17-10-4-1-5-11-17/h1-15,21-22,25H,16H2/t21-,22-,23+/m1/s1 |
| InChIKey | KAEAITWIXLBOTC-ZLNRFVROSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |