C19H20O2 — CID 124803011
(1S,2S,4R,5S)-2,5-diphenylbicyclo[2.2.1]heptane-2,5-diol (PubChem CID 124803011) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (1S,2S,4R,5S)-2,5-diphenylbicyclo[2.2.1]heptane-2,5-diol.
| Compound Name | (1S,2S,4R,5S)-2,5-diphenylbicyclo[2.2.1]heptane-2,5-diol |
|---|---|
| PubChem CID | 124803011 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1S,2S,4R,5S)-2,5-diphenylbicyclo[2.2.1]heptane-2,5-diol |
| SMILES | O[C@@]1(c2ccccc2)C[C@@H]2C[C@@H]1C[C@@]2(O)c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c20-18(14-7-3-1-4-8-14)12-17-11-16(18)13-19(17,21)15-9-5-2-6-10-15/h1-10,16-17,20-21H,11-13H2/t16-,17+,18-,19-/m1/s1 |
| InChIKey | QIRITCPOCIZVLU-FCGDIQPGSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |