C12H16O3 — CID 10560294
(1S,2S,3S)-2,3-bis(hydroxymethyl)-1-phenylcyclobutan-1-ol (PubChem CID 10560294) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1S,2S,3S)-2,3-bis(hydroxymethyl)-1-phenylcyclobutan-1-ol.
| Compound Name | (1S,2S,3S)-2,3-bis(hydroxymethyl)-1-phenylcyclobutan-1-ol |
|---|---|
| PubChem CID | 10560294 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1S,2S,3S)-2,3-bis(hydroxymethyl)-1-phenylcyclobutan-1-ol |
| SMILES | OC[C@H]1C[C@@](O)(c2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C12H16O3/c13-7-9-6-12(15,11(9)8-14)10-4-2-1-3-5-10/h1-5,9,11,13-15H,6-8H2/t9-,11-,12-/m1/s1 |
| InChIKey | MKIXTPJYTDXNPV-YUSALJHKSA-N |
| XLogP | 0.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |