C13H17NO4 — CID 10800732
3-[(1S,2S,3S)-1-hydroxy-2,3-bis(hydroxymethyl)cyclobutyl]benzamide (PubChem CID 10800732) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 3-[(1S,2S,3S)-1-hydroxy-2,3-bis(hydroxymethyl)cyclobutyl]benzamide.
| Compound Name | 3-[(1S,2S,3S)-1-hydroxy-2,3-bis(hydroxymethyl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 10800732 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[(1S,2S,3S)-1-hydroxy-2,3-bis(hydroxymethyl)cyclobutyl]benzamide |
| SMILES | NC(=O)c1cccc([C@]2(O)C[C@H](CO)[C@H]2CO)c1 |
| InChI | InChI=1S/C13H17NO4/c14-12(17)8-2-1-3-10(4-8)13(18)5-9(6-15)11(13)7-16/h1-4,9,11,15-16,18H,5-7H2,(H2,14,17)/t9-,11-,13-/m1/s1 |
| InChIKey | XCMASOKHGUZIDU-IRUJWGPZSA-N |
| XLogP | -0.41 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |