C12H15N3O — CID 90881163
3-(1,4-diazabicyclo[2.2.1]heptan-7-yl)benzamide (PubChem CID 90881163) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(1,4-diazabicyclo[2.2.1]heptan-7-yl)benzamide.
| Compound Name | 3-(1,4-diazabicyclo[2.2.1]heptan-7-yl)benzamide |
|---|---|
| PubChem CID | 90881163 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-(1,4-diazabicyclo[2.2.1]heptan-7-yl)benzamide |
| SMILES | NC(=O)c1cccc(C2N3CCN2CC3)c1 |
| InChI | InChI=1S/C12H15N3O/c13-11(16)9-2-1-3-10(8-9)12-14-4-5-15(12)7-6-14/h1-3,8,12H,4-7H2,(H2,13,16) |
| InChIKey | RZHJDNHMPUNECX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |