C17H27N3O — CID 63277160
3-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]benzamide (PubChem CID 63277160) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]benzamide.
| Compound Name | 3-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 63277160 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 3-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]benzamide |
| SMILES | CC1(C)CC(NCc2cccc(C(N)=O)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H27N3O/c1-16(2)9-14(10-17(3,4)20-16)19-11-12-6-5-7-13(8-12)15(18)21/h5-8,14,19-20H,9-11H2,1-4H3,(H2,18,21) |
| InChIKey | QKBKKXGZZCFGFD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |