C16H25BrN2 — CID 28674695
N-[(3-bromophenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 28674695) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 28674695 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC1(C)CC(NCc2cccc(Br)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H25BrN2/c1-15(2)9-14(10-16(3,4)19-15)18-11-12-6-5-7-13(17)8-12/h5-8,14,18-19H,9-11H2,1-4H3 |
| InChIKey | WXMGTRJRQLKXJC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |