C12H12O3 — CID 23256744
(1S,2S,4S,5S,6R)-6-phenyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-ol (PubChem CID 23256744) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (1S,2S,4S,5S,6R)-6-phenyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-ol.
| Compound Name | (1S,2S,4S,5S,6R)-6-phenyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-ol |
|---|---|
| PubChem CID | 23256744 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1S,2S,4S,5S,6R)-6-phenyl-3,8-dioxatricyclo[3.2.1.02,4]octan-6-ol |
| SMILES | O[C@@]1(c2ccccc2)C[C@@H]2O[C@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C12H12O3/c13-12(7-4-2-1-3-5-7)6-8-9-10(15-9)11(12)14-8/h1-5,8-11,13H,6H2/t8-,9-,10-,11-,12+/m0/s1 |
| InChIKey | QGXKCZVZNKZBFC-UHFZAUJKSA-N |
| XLogP | 0.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|