C16H18O5Se — CID 11291619
5-[(2R,4R)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-methyl-3-phenylselanyloxolan-2-one (PubChem CID 11291619) has the molecular formula C16H18O5Se and a molecular weight of 369.28 g/mol. Its IUPAC name is 5-[(2R,4R)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-methyl-3-phenylselanyloxolan-2-one.
| Compound Name | 5-[(2R,4R)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-methyl-3-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 11291619 |
| Molecular Formula | C16H18O5Se |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5-[(2R,4R)-4-methoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-methyl-3-phenylselanyloxolan-2-one |
| SMILES | CO[C@@H]1O[C@H](C2CC(C)([Se]c3ccccc3)C(=O)O2)C2OC21 |
| InChI | InChI=1S/C16H18O5Se/c1-16(22-9-6-4-3-5-7-9)8-10(19-15(16)17)11-12-13(20-12)14(18-2)21-11/h3-7,10-14H,8H2,1-2H3/t10?,11-,12?,13?,14-,16?/m1/s1 |
| InChIKey | SXQSOYVUMVCXKF-BPPHXFHISA-N |
| XLogP | 0.65 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|