C21H26O3Se — CID 10597410
(1S,3aS,8R,8aR,9aS)-8-hydroxy-1,5,8-trimethyl-1-phenylselanyl-4,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one (PubChem CID 10597410) has the molecular formula C21H26O3Se and a molecular weight of 405.40 g/mol. Its IUPAC name is (1S,3aS,8R,8aR,9aS)-8-hydroxy-1,5,8-trimethyl-1-phenylselanyl-4,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one.
| Compound Name | (1S,3aS,8R,8aR,9aS)-8-hydroxy-1,5,8-trimethyl-1-phenylselanyl-4,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one |
|---|---|
| PubChem CID | 10597410 |
| Molecular Formula | C21H26O3Se |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (1S,3aS,8R,8aR,9aS)-8-hydroxy-1,5,8-trimethyl-1-phenylselanyl-4,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-2-one |
| SMILES | CC1=C2CC[C@@](C)(O)[C@@H]2C[C@H]2[C@H](C1)OC(=O)[C@@]2(C)[Se]c1ccccc1 |
| InChI | InChI=1S/C21H26O3Se/c1-13-11-18-17(12-16-15(13)9-10-20(16,2)23)21(3,19(22)24-18)25-14-7-5-4-6-8-14/h4-8,16-18,23H,9-12H2,1-3H3/t16-,17+,18+,20-,21+/m1/s1 |
| InChIKey | GLPLBIGVMPZSNY-QBVCYTKMSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|