C16H18N2O5Se — CID 22862774
1-[(2R,4S,5R)-4-hydroxy-5-(phenylselanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 22862774) has the molecular formula C16H18N2O5Se and a molecular weight of 397.29 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(phenylselanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(phenylselanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22862774 |
| Molecular Formula | C16H18N2O5Se |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(phenylselanyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CO[Se]c3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H18N2O5Se/c1-10-8-18(16(21)17-15(10)20)14-7-12(19)13(23-14)9-22-24-11-5-3-2-4-6-11/h2-6,8,12-14,19H,7,9H2,1H3,(H,17,20,21)/t12-,13+,14+/m0/s1 |
| InChIKey | KQICQWNUBOWPGY-BFHYXJOUSA-N |
| XLogP | -0.55 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|