C13H14O2Se — CID 134989312
(1S,4S,5S)-4-phenylselanyl-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 134989312) has the molecular formula C13H14O2Se and a molecular weight of 281.21 g/mol. Its IUPAC name is (1S,4S,5S)-4-phenylselanyl-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,4S,5S)-4-phenylselanyl-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 134989312 |
| Molecular Formula | C13H14O2Se |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (1S,4S,5S)-4-phenylselanyl-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1O[C@H]2C[C@@H]1CC[C@@H]2[Se]c1ccccc1 |
| InChI | InChI=1S/C13H14O2Se/c14-13-9-6-7-12(11(8-9)15-13)16-10-4-2-1-3-5-10/h1-5,9,11-12H,6-8H2/t9-,11-,12-/m0/s1 |
| InChIKey | LVFRDRGHAVNKTQ-DLOVCJGASA-N |
| XLogP | 1.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|