C17H18OSe — CID 101160318
(2R,3S)-2-phenyl-3-phenylselanyloxane (PubChem CID 101160318) has the molecular formula C17H18OSe and a molecular weight of 317.29 g/mol. Its IUPAC name is (2R,3S)-2-phenyl-3-phenylselanyloxane.
| Compound Name | (2R,3S)-2-phenyl-3-phenylselanyloxane |
|---|---|
| PubChem CID | 101160318 |
| Molecular Formula | C17H18OSe |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (2R,3S)-2-phenyl-3-phenylselanyloxane |
| SMILES | c1ccc([Se][C@H]2CCCO[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18OSe/c1-3-8-14(9-4-1)17-16(12-7-13-18-17)19-15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2/t16-,17+/m0/s1 |
| InChIKey | UJTRPINGKMDUDD-DLBZAZTESA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|