C18H20O2Se — CID 134882559
(2S,3R)-2-(2-methoxyphenyl)-3-phenylselanyloxane (PubChem CID 134882559) has the molecular formula C18H20O2Se and a molecular weight of 347.32 g/mol. Its IUPAC name is (2S,3R)-2-(2-methoxyphenyl)-3-phenylselanyloxane.
| Compound Name | (2S,3R)-2-(2-methoxyphenyl)-3-phenylselanyloxane |
|---|---|
| PubChem CID | 134882559 |
| Molecular Formula | C18H20O2Se |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (2S,3R)-2-(2-methoxyphenyl)-3-phenylselanyloxane |
| SMILES | COc1ccccc1[C@@H]1OCCC[C@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C18H20O2Se/c1-19-16-11-6-5-10-15(16)18-17(12-7-13-20-18)21-14-8-3-2-4-9-14/h2-6,8-11,17-18H,7,12-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | VDTPNTJBPDFJNP-MSOLQXFVSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|