C14H18OSe — CID 12654992
7-phenylselanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 12654992) has the molecular formula C14H18OSe and a molecular weight of 281.26 g/mol. Its IUPAC name is 7-phenylselanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | 7-phenylselanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 12654992 |
| Molecular Formula | C14H18OSe |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 7-phenylselanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | c1ccc([Se]C2CCCC3CCOC32)cc1 |
| InChI | InChI=1S/C14H18OSe/c1-2-6-12(7-3-1)16-13-8-4-5-11-9-10-15-14(11)13/h1-3,6-7,11,13-14H,4-5,8-10H2 |
| InChIKey | FITGTLBKKAZCHD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|