About 2-phenylselanyloxane
2-phenylselanyloxane (PubChem CID 11118188) has the molecular formula C11H14OSe
and a molecular weight of 241.19 g/mol. Its IUPAC name is 2-phenylselanyloxane.
Molecular Properties
| Compound Name | 2-phenylselanyloxane |
| PubChem CID | 11118188 |
| Molecular Formula | C11H14OSe |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-phenylselanyloxane |
| SMILES | c1ccc([Se]C2CCCCO2)cc1 |
| InChI | InChI=1S/C11H14OSe/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11/h1-3,6-7,11H,4-5,8-9H2 |
| InChIKey | NCFLVQQSEWLFKQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylselanyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylselanyloxane?
The IUPAC name of 2-phenylselanyloxane (CID 11118188) is 2-phenylselanyloxane.
What is the SMILES notation for 2-phenylselanyloxane?
The canonical SMILES for 2-phenylselanyloxane is c1ccc([Se]C2CCCCO2)cc1.
What is the InChIKey of 2-phenylselanyloxane?
The InChIKey is NCFLVQQSEWLFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OSe/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11/h1-3,6-7,11H,4-5,8-9H2.
What are the key properties of 2-phenylselanyloxane?
2-phenylselanyloxane has a molecular weight of 241.19 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylselanyloxane is sourced from PubChem (CID 11118188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).