C18H22OSe — CID 44631177
(1S,6S,7E)-7-[(2R)-2-phenylselanylcyclohexylidene]-2-oxabicyclo[4.1.0]heptane (PubChem CID 44631177) has the molecular formula C18H22OSe and a molecular weight of 333.33 g/mol. Its IUPAC name is (1S,6S,7E)-7-[(2R)-2-phenylselanylcyclohexylidene]-2-oxabicyclo[4.1.0]heptane.
| Compound Name | (1S,6S,7E)-7-[(2R)-2-phenylselanylcyclohexylidene]-2-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 44631177 |
| Molecular Formula | C18H22OSe |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (1S,6S,7E)-7-[(2R)-2-phenylselanylcyclohexylidene]-2-oxabicyclo[4.1.0]heptane |
| SMILES | c1ccc([Se][C@@H]2CCCC/C2=C2\[C@H]3OCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C18H22OSe/c1-2-7-13(8-3-1)20-16-11-5-4-9-14(16)17-15-10-6-12-19-18(15)17/h1-3,7-8,15-16,18H,4-6,9-12H2/b17-14+/t15-,16+,18-/m0/s1 |
| InChIKey | AVSUMUCBRNFWQI-LGWRLIGDSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|