C11H14OSe — CID 15890900
(2R,3S)-3-methyl-2-phenylselanyloxolane (PubChem CID 15890900) has the molecular formula C11H14OSe and a molecular weight of 241.19 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-phenylselanyloxolane.
| Compound Name | (2R,3S)-3-methyl-2-phenylselanyloxolane |
|---|---|
| PubChem CID | 15890900 |
| Molecular Formula | C11H14OSe |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | (2R,3S)-3-methyl-2-phenylselanyloxolane |
| SMILES | C[C@H]1CCO[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C11H14OSe/c1-9-7-8-12-11(9)13-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | LFPZJESLULMZLZ-GXSJLCMTSA-N |
| XLogP | 1.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|