C14H18O4Se — CID 10925515
(3aR,4S,7R,7aS)-2,2-dimethyl-4-phenylselanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 10925515) has the molecular formula C14H18O4Se and a molecular weight of 329.25 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2,2-dimethyl-4-phenylselanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,4S,7R,7aS)-2,2-dimethyl-4-phenylselanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 10925515 |
| Molecular Formula | C14H18O4Se |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (3aR,4S,7R,7aS)-2,2-dimethyl-4-phenylselanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H]([Se]c1ccccc1)OC[C@H]2O |
| InChI | InChI=1S/C14H18O4Se/c1-14(2)17-11-10(15)8-16-13(12(11)18-14)19-9-6-4-3-5-7-9/h3-7,10-13,15H,8H2,1-2H3/t10-,11+,12-,13+/m1/s1 |
| InChIKey | MGVMPJNWIWDOPN-XQHKEYJVSA-N |
| XLogP | 0.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|