C14H16O4 — CID 177342402
(1R,7R)-4,4-dimethyl-1-phenyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane (PubChem CID 177342402) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1R,7R)-4,4-dimethyl-1-phenyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,7R)-4,4-dimethyl-1-phenyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 177342402 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1R,7R)-4,4-dimethyl-1-phenyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decane |
| SMILES | CC1(C)OC2C(O1)[C@@]1(c3ccccc3)CO[C@@H]2O1 |
| InChI | InChI=1S/C14H16O4/c1-13(2)16-10-11(17-13)14(8-15-12(10)18-14)9-6-4-3-5-7-9/h3-7,10-12H,8H2,1-2H3/t10?,11?,12-,14+/m1/s1 |
| InChIKey | GCRFKDBJDSOFRZ-YZVRNYIASA-N |
| XLogP | 1.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |