C35H37O4P — CID 162462396
(3aS,8aS)-6-tert-butyl-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine (PubChem CID 162462396) has the molecular formula C35H37O4P and a molecular weight of 552.65 g/mol. Its IUPAC name is (3aS,8aS)-6-tert-butyl-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine.
| Compound Name | (3aS,8aS)-6-tert-butyl-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
|---|---|
| PubChem CID | 162462396 |
| Molecular Formula | C35H37O4P |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (3aS,8aS)-6-tert-butyl-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
| SMILES | CC1(C)O[C@H]2[C@H](O1)C(c1ccccc1)(c1ccccc1)OP(C(C)(C)C)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H37O4P/c1-32(2,3)40-38-34(26-18-10-6-11-19-26,27-20-12-7-13-21-27)30-31(37-33(4,5)36-30)35(39-40,28-22-14-8-15-23-28)29-24-16-9-17-25-29/h6-25,30-31H,1-5H3/t30-,31-/m0/s1 |
| InChIKey | GFEJWIOQSXCTKV-CONSDPRKSA-N |
| XLogP | 8.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|