C35H37O5P — CID 102012189
(3aR,8aR)-6-[(2R)-butan-2-yl]oxy-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine (PubChem CID 102012189) has the molecular formula C35H37O5P and a molecular weight of 568.65 g/mol. Its IUPAC name is (3aR,8aR)-6-[(2R)-butan-2-yl]oxy-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine.
| Compound Name | (3aR,8aR)-6-[(2R)-butan-2-yl]oxy-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
|---|---|
| PubChem CID | 102012189 |
| Molecular Formula | C35H37O5P |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | (3aR,8aR)-6-[(2R)-butan-2-yl]oxy-2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
| SMILES | CC[C@@H](C)OP1OC(c2ccccc2)(c2ccccc2)[C@@H]2OC(C)(C)O[C@H]2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C35H37O5P/c1-5-26(2)38-41-39-34(27-18-10-6-11-19-27,28-20-12-7-13-21-28)31-32(37-33(3,4)36-31)35(40-41,29-22-14-8-15-23-29)30-24-16-9-17-25-30/h6-26,31-32H,5H2,1-4H3/t26-,31-,32-/m1/s1 |
| InChIKey | QXCDIYPCFGBRHY-RJHDZTQMSA-N |
| XLogP | 8.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|