C32H32NO4P — CID 101072445
(3aS,8aS)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine (PubChem CID 101072445) has the molecular formula C32H32NO4P and a molecular weight of 525.59 g/mol. Its IUPAC name is (3aS,8aS)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine.
| Compound Name | (3aS,8aS)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine |
|---|---|
| PubChem CID | 101072445 |
| Molecular Formula | C32H32NO4P |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | (3aS,8aS)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine |
| SMILES | CNP1OC(c2ccccc2)(c2ccccc2)[C@H]2OC(C)(C)O[C@@H]2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C32H32NO4P/c1-30(2)34-28-29(35-30)32(26-20-12-6-13-21-26,27-22-14-7-15-23-27)37-38(33-3)36-31(28,24-16-8-4-9-17-24)25-18-10-5-11-19-25/h4-23,28-29,33H,1-3H3/t28-,29-/m0/s1 |
| InChIKey | MEOGXBOUVWZKNU-VMPREFPWSA-N |
| XLogP | 6.89 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|