C40H40NO4P — CID 102254569
(3aR,8aR)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-N-[(1R)-1-phenylethyl]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine (PubChem CID 102254569) has the molecular formula C40H40NO4P and a molecular weight of 629.74 g/mol. Its IUPAC name is (3aR,8aR)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-N-[(1R)-1-phenylethyl]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine.
| Compound Name | (3aR,8aR)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-N-[(1R)-1-phenylethyl]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine |
|---|---|
| PubChem CID | 102254569 |
| Molecular Formula | C40H40NO4P |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | (3aR,8aR)-N,2,2-trimethyl-4,4,8,8-tetraphenyl-N-[(1R)-1-phenylethyl]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine |
| SMILES | C[C@H](c1ccccc1)N(C)P1OC(c2ccccc2)(c2ccccc2)[C@@H]2OC(C)(C)O[C@H]2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C40H40NO4P/c1-30(31-20-10-5-11-21-31)41(4)46-44-39(32-22-12-6-13-23-32,33-24-14-7-15-25-33)36-37(43-38(2,3)42-36)40(45-46,34-26-16-8-17-27-34)35-28-18-9-19-29-35/h5-30,36-37H,1-4H3/t30-,36-,37-/m1/s1 |
| InChIKey | RJSIKBSFDBHBRN-QPQSGNJTSA-N |
| XLogP | 9.36 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|