C31H28O5P+ — CID 11191491
2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-ium 6-oxide (PubChem CID 11191491) has the molecular formula C31H28O5P+ and a molecular weight of 511.53 g/mol. Its IUPAC name is 2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-ium 6-oxide.
| Compound Name | 2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-ium 6-oxide |
|---|---|
| PubChem CID | 11191491 |
| Molecular Formula | C31H28O5P+ |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2,2-dimethyl-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-ium 6-oxide |
| SMILES | CC1(C)OC2C(O1)C(c1ccccc1)(c1ccccc1)O[P+](=O)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28O5P/c1-29(2)33-27-28(34-29)31(25-19-11-5-12-20-25,26-21-13-6-14-22-26)36-37(32)35-30(27,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h3-22,27-28H,1-2H3/q+1 |
| InChIKey | GYGBGEFVNOYZOI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|