C36H37O6P — CID 102012182
(3aR,8aR)-2,2-dimethyl-6-(oxolan-2-ylmethoxy)-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine (PubChem CID 102012182) has the molecular formula C36H37O6P and a molecular weight of 596.66 g/mol. Its IUPAC name is (3aR,8aR)-2,2-dimethyl-6-(oxolan-2-ylmethoxy)-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine.
| Compound Name | (3aR,8aR)-2,2-dimethyl-6-(oxolan-2-ylmethoxy)-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
|---|---|
| PubChem CID | 102012182 |
| Molecular Formula | C36H37O6P |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (3aR,8aR)-2,2-dimethyl-6-(oxolan-2-ylmethoxy)-4,4,8,8-tetraphenyl-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)C(c1ccccc1)(c1ccccc1)OP(OCC1CCCO1)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37O6P/c1-34(2)39-32-33(40-34)36(29-20-11-5-12-21-29,30-22-13-6-14-23-30)42-43(38-26-31-24-15-25-37-31)41-35(32,27-16-7-3-8-17-27)28-18-9-4-10-19-28/h3-14,16-23,31-33H,15,24-26H2,1-2H3/t31?,32-,33-/m1/s1 |
| InChIKey | WRLRSYYLLUOBDW-HCMUIWFFSA-N |
| XLogP | 7.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|