C21H22O3 — CID 10358761
(3aS,4R,7aR)-2,2-dimethyl-7,7-diphenyl-4,7a-dihydro-3aH-1,3-benzodioxol-4-ol (PubChem CID 10358761) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is (3aS,4R,7aR)-2,2-dimethyl-7,7-diphenyl-4,7a-dihydro-3aH-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,7aR)-2,2-dimethyl-7,7-diphenyl-4,7a-dihydro-3aH-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 10358761 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3aS,4R,7aR)-2,2-dimethyl-7,7-diphenyl-4,7a-dihydro-3aH-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)C=CC(c3ccccc3)(c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C21H22O3/c1-20(2)23-18-17(22)13-14-21(19(18)24-20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,17-19,22H,1-2H3/t17-,18+,19+/m1/s1 |
| InChIKey | MCLVPZQZSPFDCX-QYZOEREBSA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|