C16H16O2 — CID 134930519
(R)-[(2S,3S)-3-methyl-2-phenyloxiran-2-yl]-phenylmethanol (PubChem CID 134930519) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (R)-[(2S,3S)-3-methyl-2-phenyloxiran-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2S,3S)-3-methyl-2-phenyloxiran-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 134930519 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (R)-[(2S,3S)-3-methyl-2-phenyloxiran-2-yl]-phenylmethanol |
| SMILES | C[C@@H]1O[C@@]1(c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H16O2/c1-12-16(18-12,14-10-6-3-7-11-14)15(17)13-8-4-2-5-9-13/h2-12,15,17H,1H3/t12-,15+,16-/m0/s1 |
| InChIKey | QYRMNPSTKPGKKG-MAZHCROVSA-N |
| XLogP | 3.03 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|