C16H16O3 — CID 41097603
(R)-phenyl-(2-phenyl-1,3-dioxolan-2-yl)methanol (PubChem CID 41097603) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (R)-phenyl-(2-phenyl-1,3-dioxolan-2-yl)methanol.
| Compound Name | (R)-phenyl-(2-phenyl-1,3-dioxolan-2-yl)methanol |
|---|---|
| PubChem CID | 41097603 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (R)-phenyl-(2-phenyl-1,3-dioxolan-2-yl)methanol |
| SMILES | O[C@H](c1ccccc1)C1(c2ccccc2)OCCO1 |
| InChI | InChI=1S/C16H16O3/c17-15(13-7-3-1-4-8-13)16(18-11-12-19-16)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/t15-/m1/s1 |
| InChIKey | HAEGULPLPHZWMP-OAHLLOKOSA-N |
| XLogP | 2.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |