C23H30O4 — CID 66788783
1-[2-[hydroxy(phenyl)methyl]-2-phenyl-1,3-dioxan-4-yl]hexan-1-ol (PubChem CID 66788783) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[2-[hydroxy(phenyl)methyl]-2-phenyl-1,3-dioxan-4-yl]hexan-1-ol.
| Compound Name | 1-[2-[hydroxy(phenyl)methyl]-2-phenyl-1,3-dioxan-4-yl]hexan-1-ol |
|---|---|
| PubChem CID | 66788783 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[2-[hydroxy(phenyl)methyl]-2-phenyl-1,3-dioxan-4-yl]hexan-1-ol |
| SMILES | CCCCCC(O)C1CCOC(c2ccccc2)(C(O)c2ccccc2)O1 |
| InChI | InChI=1S/C23H30O4/c1-2-3-6-15-20(24)21-16-17-26-23(27-21,19-13-9-5-10-14-19)22(25)18-11-7-4-8-12-18/h4-5,7-14,20-22,24-25H,2-3,6,15-17H2,1H3 |
| InChIKey | ABWJYGVFOZXGLY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|