C22H26O3 — CID 129360239
(R)-[(3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-2-yl]-phenylmethanol (PubChem CID 129360239) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (R)-[(3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-2-yl]-phenylmethanol.
| Compound Name | (R)-[(3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 129360239 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (R)-[(3aR,9aR)-2-phenyl-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dioxol-2-yl]-phenylmethanol |
| SMILES | O[C@H](c1ccccc1)C1(c2ccccc2)O[C@@H]2CCCCCC[C@H]2O1 |
| InChI | InChI=1S/C22H26O3/c23-21(17-11-5-3-6-12-17)22(18-13-7-4-8-14-18)24-19-15-9-1-2-10-16-20(19)25-22/h3-8,11-14,19-21,23H,1-2,9-10,15-16H2/t19-,20-,21-/m1/s1 |
| InChIKey | OCBKKPZQWLEFFE-NJDAHSKKSA-N |
| XLogP | 4.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |