C14H17BrO — CID 7036761
(S)-[(1S,6S)-7-bromo-7-bicyclo[4.1.0]heptanyl]-phenylmethanol (PubChem CID 7036761) has the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. Its IUPAC name is (S)-[(1S,6S)-7-bromo-7-bicyclo[4.1.0]heptanyl]-phenylmethanol.
| Compound Name | (S)-[(1S,6S)-7-bromo-7-bicyclo[4.1.0]heptanyl]-phenylmethanol |
|---|---|
| PubChem CID | 7036761 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (S)-[(1S,6S)-7-bromo-7-bicyclo[4.1.0]heptanyl]-phenylmethanol |
| SMILES | O[C@@H](c1ccccc1)C1(Br)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H17BrO/c15-14(11-8-4-5-9-12(11)14)13(16)10-6-2-1-3-7-10/h1-3,6-7,11-13,16H,4-5,8-9H2/t11-,12-,13-/m0/s1 |
| InChIKey | VCLHWKWUHGBUCU-AVGNSLFASA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|