C17H17BrO — CID 6933101
(S)-[(1R,2R)-1-bromo-2-methyl-2-phenylcyclopropyl]-phenylmethanol (PubChem CID 6933101) has the molecular formula C17H17BrO and a molecular weight of 317.23 g/mol. Its IUPAC name is (S)-[(1R,2R)-1-bromo-2-methyl-2-phenylcyclopropyl]-phenylmethanol.
| Compound Name | (S)-[(1R,2R)-1-bromo-2-methyl-2-phenylcyclopropyl]-phenylmethanol |
|---|---|
| PubChem CID | 6933101 |
| Molecular Formula | C17H17BrO |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (S)-[(1R,2R)-1-bromo-2-methyl-2-phenylcyclopropyl]-phenylmethanol |
| SMILES | C[C@]1(c2ccccc2)C[C@]1(Br)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H17BrO/c1-16(14-10-6-3-7-11-14)12-17(16,18)15(19)13-8-4-2-5-9-13/h2-11,15,19H,12H2,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | PDOVJOSTBJWXKE-BBWFWOEESA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|