C25H28OSi — CID 99771519
(R)-[(1S)-2,2-diphenyl-1-trimethylsilylcyclopropyl]-phenylmethanol (PubChem CID 99771519) has the molecular formula C25H28OSi and a molecular weight of 372.58 g/mol. Its IUPAC name is (R)-[(1S)-2,2-diphenyl-1-trimethylsilylcyclopropyl]-phenylmethanol.
| Compound Name | (R)-[(1S)-2,2-diphenyl-1-trimethylsilylcyclopropyl]-phenylmethanol |
|---|---|
| PubChem CID | 99771519 |
| Molecular Formula | C25H28OSi |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (R)-[(1S)-2,2-diphenyl-1-trimethylsilylcyclopropyl]-phenylmethanol |
| SMILES | C[Si](C)(C)[C@@]1([C@H](O)c2ccccc2)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28OSi/c1-27(2,3)25(23(26)20-13-7-4-8-14-20)19-24(25,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23,26H,19H2,1-3H3/t23-,25-/m1/s1 |
| InChIKey | DGDDYYWJAPYTEG-ILBGXUMGSA-N |
| XLogP | 6.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|