C15H24OSi — CID 101172105
[(2R,3S)-2,3-dimethyl-1-trimethylsilylcyclopropyl]-phenylmethanol (PubChem CID 101172105) has the molecular formula C15H24OSi and a molecular weight of 248.44 g/mol. Its IUPAC name is [(2R,3S)-2,3-dimethyl-1-trimethylsilylcyclopropyl]-phenylmethanol.
| Compound Name | [(2R,3S)-2,3-dimethyl-1-trimethylsilylcyclopropyl]-phenylmethanol |
|---|---|
| PubChem CID | 101172105 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(2R,3S)-2,3-dimethyl-1-trimethylsilylcyclopropyl]-phenylmethanol |
| SMILES | C[C@@H]1[C@H](C)C1(C(O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H24OSi/c1-11-12(2)15(11,17(3,4)5)14(16)13-9-7-6-8-10-13/h6-12,14,16H,1-5H3/t11-,12+,14?,15? |
| InChIKey | KGBLSRSSSCVZTK-AVJIGQEQSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|