C15H22O2 — CID 15259342
1-[(2R,3S)-2-phenyloxetan-3-yl]hexan-1-ol (PubChem CID 15259342) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[(2R,3S)-2-phenyloxetan-3-yl]hexan-1-ol.
| Compound Name | 1-[(2R,3S)-2-phenyloxetan-3-yl]hexan-1-ol |
|---|---|
| PubChem CID | 15259342 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-[(2R,3S)-2-phenyloxetan-3-yl]hexan-1-ol |
| SMILES | CCCCCC(O)[C@@H]1CO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H22O2/c1-2-3-5-10-14(16)13-11-17-15(13)12-8-6-4-7-9-12/h4,6-9,13-16H,2-3,5,10-11H2,1H3/t13-,14?,15-/m0/s1 |
| InChIKey | BKIADUGTLCELKD-LWEDLAQUSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|