C11H18O2 — CID 134928946
(1R)-1-[(2S,3R)-2-ethynyloxetan-3-yl]hexan-1-ol (PubChem CID 134928946) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1R)-1-[(2S,3R)-2-ethynyloxetan-3-yl]hexan-1-ol.
| Compound Name | (1R)-1-[(2S,3R)-2-ethynyloxetan-3-yl]hexan-1-ol |
|---|---|
| PubChem CID | 134928946 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1R)-1-[(2S,3R)-2-ethynyloxetan-3-yl]hexan-1-ol |
| SMILES | C#C[C@H]1OC[C@@H]1[C@H](O)CCCCC |
| InChI | InChI=1S/C11H18O2/c1-3-5-6-7-10(12)9-8-13-11(9)4-2/h2,9-12H,3,5-8H2,1H3/t9-,10-,11-/m1/s1 |
| InChIKey | WEEMVTQEFFIXRX-GMTAPVOTSA-N |
| XLogP | 1.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|