C11H15O3P — CID 141057918
4-tert-butyl-2-hydroxy-4-phenyl-1,3,2-dioxaphosphetane (PubChem CID 141057918) has the molecular formula C11H15O3P and a molecular weight of 226.21 g/mol. Its IUPAC name is 4-tert-butyl-2-hydroxy-4-phenyl-1,3,2-dioxaphosphetane.
| Compound Name | 4-tert-butyl-2-hydroxy-4-phenyl-1,3,2-dioxaphosphetane |
|---|---|
| PubChem CID | 141057918 |
| Molecular Formula | C11H15O3P |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-tert-butyl-2-hydroxy-4-phenyl-1,3,2-dioxaphosphetane |
| SMILES | CC(C)(C)C1(c2ccccc2)OP(O)O1 |
| InChI | InChI=1S/C11H15O3P/c1-10(2,3)11(13-15(12)14-11)9-7-5-4-6-8-9/h4-8,12H,1-3H3 |
| InChIKey | VJUYAFASHMAOER-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|