C27H23AlO2 — CID 16688767
2-methyl-4,4,5,5-tetraphenyl-1,3,2-dioxalumolane (PubChem CID 16688767) has the molecular formula C27H23AlO2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-methyl-4,4,5,5-tetraphenyl-1,3,2-dioxalumolane.
| Compound Name | 2-methyl-4,4,5,5-tetraphenyl-1,3,2-dioxalumolane |
|---|---|
| PubChem CID | 16688767 |
| Molecular Formula | C27H23AlO2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-methyl-4,4,5,5-tetraphenyl-1,3,2-dioxalumolane |
| SMILES | C[Al]1OC(c2ccccc2)(c2ccccc2)C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C26H20O2.CH3.Al/c27-25(21-13-5-1-6-14-21,22-15-7-2-8-16-22)26(28,23-17-9-3-10-18-23)24-19-11-4-12-20-24;;/h1-20H;1H3;/q-2;;+2 |
| InChIKey | PAQISRUEYTWWER-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |