C19H22O2 — CID 15531973
(2,2,3-trimethyl-4,4-diphenyloxetan-3-yl)methanol (PubChem CID 15531973) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2,2,3-trimethyl-4,4-diphenyloxetan-3-yl)methanol.
| Compound Name | (2,2,3-trimethyl-4,4-diphenyloxetan-3-yl)methanol |
|---|---|
| PubChem CID | 15531973 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2,2,3-trimethyl-4,4-diphenyloxetan-3-yl)methanol |
| SMILES | CC1(C)OC(c2ccccc2)(c2ccccc2)C1(C)CO |
| InChI | InChI=1S/C19H22O2/c1-17(2)18(3,14-20)19(21-17,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,20H,14H2,1-3H3 |
| InChIKey | UNNNMNNMAFDYBH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |