C22H18O2 — CID 100931886
[(2R)-2-methyl-3,3-diphenyloxiran-2-yl]-phenylmethanone (PubChem CID 100931886) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(2R)-2-methyl-3,3-diphenyloxiran-2-yl]-phenylmethanone.
| Compound Name | [(2R)-2-methyl-3,3-diphenyloxiran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 100931886 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(2R)-2-methyl-3,3-diphenyloxiran-2-yl]-phenylmethanone |
| SMILES | C[C@@]1(C(=O)c2ccccc2)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18O2/c1-21(20(23)17-11-5-2-6-12-17)22(24-21,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3/t21-/m0/s1 |
| InChIKey | YCSMAWOHBHGGNE-NRFANRHFSA-N |
| XLogP | 4.60 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|