C26H28O6 — CID 10741578
(2S,6S,8S,12S,14S)-4,4,10,10-tetramethyl-2',2'-diphenylspiro[3,5,9,11,13-pentaoxatetracyclo[5.5.2.02,6.08,12]tetradecane-14,3'-oxirane] (PubChem CID 10741578) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is (2S,6S,8S,12S,14S)-4,4,10,10-tetramethyl-2',2'-diphenylspiro[3,5,9,11,13-pentaoxatetracyclo[5.5.2.02,6.08,12]tetradecane-14,3'-oxirane].
| Compound Name | (2S,6S,8S,12S,14S)-4,4,10,10-tetramethyl-2',2'-diphenylspiro[3,5,9,11,13-pentaoxatetracyclo[5.5.2.02,6.08,12]tetradecane-14,3'-oxirane] |
|---|---|
| PubChem CID | 10741578 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2S,6S,8S,12S,14S)-4,4,10,10-tetramethyl-2',2'-diphenylspiro[3,5,9,11,13-pentaoxatetracyclo[5.5.2.02,6.08,12]tetradecane-14,3'-oxirane] |
| SMILES | CC1(C)O[C@@H]2C3O[C@]4(OC4(c4ccccc4)c4ccccc4)C([C@@H]2O1)[C@@H]1OC(C)(C)O[C@H]31 |
| InChI | InChI=1S/C26H28O6/c1-23(2)27-18-17-19-21(30-24(3,4)28-19)22(20(18)29-23)31-26(17)25(32-26,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17-22H,1-4H3/t17?,18-,19-,20-,21-,22?,26-/m0/s1 |
| InChIKey | IBQIAEQAKGIYAW-HMBOYNGZSA-N |
| XLogP | 3.73 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|