C24H36O4P2 — CID 139305520
(4R,6R,6aS)-5-[2-[(3aS,4R,6R)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxol-5-yl]phenyl]-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxole (PubChem CID 139305520) has the molecular formula C24H36O4P2 and a molecular weight of 450.50 g/mol. Its IUPAC name is (4R,6R,6aS)-5-[2-[(3aS,4R,6R)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxol-5-yl]phenyl]-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxole.
| Compound Name | (4R,6R,6aS)-5-[2-[(3aS,4R,6R)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxol-5-yl]phenyl]-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 139305520 |
| Molecular Formula | C24H36O4P2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (4R,6R,6aS)-5-[2-[(3aS,4R,6R)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxol-5-yl]phenyl]-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrophospholo[3,4-d][1,3]dioxole |
| SMILES | C[C@@H]1C2OC(C)(C)O[C@@H]2[C@@H](C)P1c1ccccc1P1[C@H](C)C2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C24H36O4P2/c1-13-19-20(26-23(5,6)25-19)14(2)29(13)17-11-9-10-12-18(17)30-15(3)21-22(16(30)4)28-24(7,8)27-21/h9-16,19-22H,1-8H3/t13-,14-,15-,16-,19-,20?,21-,22?,29?,30?/m1/s1 |
| InChIKey | FAXNYESSWMPAKD-KPEUNKKESA-N |
| XLogP | 4.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|