C8H14O5 — CID 55250433
(6R,7S,7aR)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol (PubChem CID 55250433) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (6R,7S,7aR)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol.
| Compound Name | (6R,7S,7aR)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 55250433 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (6R,7S,7aR)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
| SMILES | CC1(C)OC2OC[C@@H](O)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C8H14O5/c1-8(2)12-6-5(10)4(9)3-11-7(6)13-8/h4-7,9-10H,3H2,1-2H3/t4-,5+,6-,7?/m1/s1 |
| InChIKey | ZCTUVSXGVGDKNK-JFRCYRBUSA-N |
| XLogP | -0.78 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |