C18H22O7Se — CID 135078121
(4,5-diacetyloxy-2-methyl-6-phenylselanyloxan-3-yl) acetate (PubChem CID 135078121) has the molecular formula C18H22O7Se and a molecular weight of 429.33 g/mol. Its IUPAC name is (4,5-diacetyloxy-2-methyl-6-phenylselanyloxan-3-yl) acetate.
| Compound Name | (4,5-diacetyloxy-2-methyl-6-phenylselanyloxan-3-yl) acetate |
|---|---|
| PubChem CID | 135078121 |
| Molecular Formula | C18H22O7Se |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (4,5-diacetyloxy-2-methyl-6-phenylselanyloxan-3-yl) acetate |
| SMILES | CC(=O)OC1C(C)OC([Se]c2ccccc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H22O7Se/c1-10-15(23-11(2)19)16(24-12(3)20)17(25-13(4)21)18(22-10)26-14-8-6-5-7-9-14/h5-10,15-18H,1-4H3 |
| InChIKey | GKSVPKIDNZPSNR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|